C23H32N4O2 — CID 174525506
N-(3-aminopropyl)-3-(hydroxymethyl)-N-(4-phenylmethoxyphenyl)piperidine-1-carboximidamide (PubChem CID 174525506) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-(hydroxymethyl)-N-(4-phenylmethoxyphenyl)piperidine-1-carboximidamide.
| Compound Name | N-(3-aminopropyl)-3-(hydroxymethyl)-N-(4-phenylmethoxyphenyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 174525506 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | N-(3-aminopropyl)-3-(hydroxymethyl)-N-(4-phenylmethoxyphenyl)piperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N1CCCC(CO)C1)N(CCCN)c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H32N4O2/c24-13-5-15-27(23(25)26-14-4-8-20(16-26)17-28)21-9-11-22(12-10-21)29-18-19-6-2-1-3-7-19/h1-3,6-7,9-12,20,25,28H,4-5,8,13-18,24H2/b25-23+ |
| InChIKey | FWRJRLUJGDNTTM-WJTDDFOZSA-N |
| XLogP | 3.06 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|