C26H38N4O3S — CID 174511490
N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-[4-[(4-methylsulfonylphenyl)methoxy]phenyl]piperidine-1-carboximidamide (PubChem CID 174511490) has the molecular formula C26H38N4O3S and a molecular weight of 486.68 g/mol. Its IUPAC name is N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-[4-[(4-methylsulfonylphenyl)methoxy]phenyl]piperidine-1-carboximidamide.
| Compound Name | N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-[4-[(4-methylsulfonylphenyl)methoxy]phenyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 174511490 |
| Molecular Formula | C26H38N4O3S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | N-(3-amino-2,2-dimethylpropyl)-3-methyl-N-[4-[(4-methylsulfonylphenyl)methoxy]phenyl]piperidine-1-carboximidamide |
| SMILES | [H]/N=C(\N1CCCC(C)C1)N(CC(C)(C)CN)c1ccc(OCc2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C26H38N4O3S/c1-20-6-5-15-29(16-20)25(28)30(19-26(2,3)18-27)22-9-11-23(12-10-22)33-17-21-7-13-24(14-8-21)34(4,31)32/h7-14,20,28H,5-6,15-19,27H2,1-4H3/b28-25+ |
| InChIKey | SDZVPPMVPYVECC-AZPGRJICSA-N |
| XLogP | 4.13 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|