C17H25NO4S — CID 94822355
1-[(3R)-3-methylpiperidin-1-yl]-4-(4-methylsulfonylphenoxy)butan-1-one (PubChem CID 94822355) has the molecular formula C17H25NO4S and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-[(3R)-3-methylpiperidin-1-yl]-4-(4-methylsulfonylphenoxy)butan-1-one.
| Compound Name | 1-[(3R)-3-methylpiperidin-1-yl]-4-(4-methylsulfonylphenoxy)butan-1-one |
|---|---|
| PubChem CID | 94822355 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | 1-[(3R)-3-methylpiperidin-1-yl]-4-(4-methylsulfonylphenoxy)butan-1-one |
| SMILES | C[C@@H]1CCCN(C(=O)CCCOc2ccc(S(C)(=O)=O)cc2)C1 |
| InChI | InChI=1S/C17H25NO4S/c1-14-5-3-11-18(13-14)17(19)6-4-12-22-15-7-9-16(10-8-15)23(2,20)21/h7-10,14H,3-6,11-13H2,1-2H3/t14-/m1/s1 |
| InChIKey | RGDIBTMFYQCIGG-CQSZACIVSA-N |
| XLogP | 2.51 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|