C16H21NO6S — CID 125135098
(3R)-1-[4-(4-methylsulfonylphenoxy)butanoyl]pyrrolidine-3-carboxylic acid (PubChem CID 125135098) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is (3R)-1-[4-(4-methylsulfonylphenoxy)butanoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-[4-(4-methylsulfonylphenoxy)butanoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 125135098 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (3R)-1-[4-(4-methylsulfonylphenoxy)butanoyl]pyrrolidine-3-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccc(OCCCC(=O)N2CC[C@@H](C(=O)O)C2)cc1 |
| InChI | InChI=1S/C16H21NO6S/c1-24(21,22)14-6-4-13(5-7-14)23-10-2-3-15(18)17-9-8-12(11-17)16(19)20/h4-7,12H,2-3,8-11H2,1H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | YSVCWWZIXUFFCR-GFCCVEGCSA-N |
| XLogP | 1.18 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|