C18H28N2O4S — CID 124691614
1-[(2S,3R)-2-(aminomethyl)-3-methylpiperidin-1-yl]-4-(4-methylsulfonylphenoxy)butan-1-one (PubChem CID 124691614) has the molecular formula C18H28N2O4S and a molecular weight of 368.50 g/mol. Its IUPAC name is 1-[(2S,3R)-2-(aminomethyl)-3-methylpiperidin-1-yl]-4-(4-methylsulfonylphenoxy)butan-1-one.
| Compound Name | 1-[(2S,3R)-2-(aminomethyl)-3-methylpiperidin-1-yl]-4-(4-methylsulfonylphenoxy)butan-1-one |
|---|---|
| PubChem CID | 124691614 |
| Molecular Formula | C18H28N2O4S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-[(2S,3R)-2-(aminomethyl)-3-methylpiperidin-1-yl]-4-(4-methylsulfonylphenoxy)butan-1-one |
| SMILES | C[C@@H]1CCCN(C(=O)CCCOc2ccc(S(C)(=O)=O)cc2)[C@@H]1CN |
| InChI | InChI=1S/C18H28N2O4S/c1-14-5-3-11-20(17(14)13-19)18(21)6-4-12-24-15-7-9-16(10-8-15)25(2,22)23/h7-10,14,17H,3-6,11-13,19H2,1-2H3/t14-,17-/m1/s1 |
| InChIKey | LKUGYIOUXXAJGW-RHSMWYFYSA-N |
| XLogP | 1.83 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|