C41H36FNO — CID 174525608
(9-amino-2,2-dibenzyl-1,1-dimethyl-3,6-dihydrochrysen-3-yl)-(4-fluorophenyl)methanone (PubChem CID 174525608) has the molecular formula C41H36FNO and a molecular weight of 577.74 g/mol. Its IUPAC name is (9-amino-2,2-dibenzyl-1,1-dimethyl-3,6-dihydrochrysen-3-yl)-(4-fluorophenyl)methanone.
| Compound Name | (9-amino-2,2-dibenzyl-1,1-dimethyl-3,6-dihydrochrysen-3-yl)-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 174525608 |
| Molecular Formula | C41H36FNO |
| Molecular Weight | 577.74 g/mol |
| Exact Mass | 577.28 |
| IUPAC Name | (9-amino-2,2-dibenzyl-1,1-dimethyl-3,6-dihydrochrysen-3-yl)-(4-fluorophenyl)methanone |
| SMILES | CC1(C)c2ccc3c(c2=CC(C(=O)c2ccc(F)cc2)C1(Cc1ccccc1)Cc1ccccc1)=CCc1ccc(N)cc1-3 |
| InChI | InChI=1S/C41H36FNO/c1-40(2)37-22-21-33-34(20-16-29-15-19-32(43)23-35(29)33)36(37)24-38(39(44)30-13-17-31(42)18-14-30)41(40,25-27-9-5-3-6-10-27)26-28-11-7-4-8-12-28/h3-15,17-24,38H,16,25-26,43H2,1-2H3 |
| InChIKey | FKSIPHNGBNMULI-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.74 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|