C32H29NO4S — CID 174525662
2-[3-(3,4-dimethoxyphenyl)sulfonyl-1,2,3,6-tetrahydrochrysen-1-yl]-1H-azepine (PubChem CID 174525662) has the molecular formula C32H29NO4S and a molecular weight of 523.65 g/mol. Its IUPAC name is 2-[3-(3,4-dimethoxyphenyl)sulfonyl-1,2,3,6-tetrahydrochrysen-1-yl]-1H-azepine.
| Compound Name | 2-[3-(3,4-dimethoxyphenyl)sulfonyl-1,2,3,6-tetrahydrochrysen-1-yl]-1H-azepine |
|---|---|
| PubChem CID | 174525662 |
| Molecular Formula | C32H29NO4S |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | 2-[3-(3,4-dimethoxyphenyl)sulfonyl-1,2,3,6-tetrahydrochrysen-1-yl]-1H-azepine |
| SMILES | COc1ccc(S(=O)(=O)C2C=c3c(ccc4c3=CCc3ccccc3-4)C(C3=CC=CC=CN3)C2)cc1OC |
| InChI | InChI=1S/C32H29NO4S/c1-36-31-16-12-22(20-32(31)37-2)38(34,35)23-18-28-26-13-11-21-8-5-6-9-24(21)25(26)14-15-27(28)29(19-23)30-10-4-3-7-17-33-30/h3-10,12-18,20,23,29,33H,11,19H2,1-2H3 |
| InChIKey | VFLFDCARXJGBKO-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |