C26H26O4S — CID 174352406
5-(3,4-dimethoxyphenyl)sulfonyl-1,2,3,4,5,6-hexahydrochrysene (PubChem CID 174352406) has the molecular formula C26H26O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is 5-(3,4-dimethoxyphenyl)sulfonyl-1,2,3,4,5,6-hexahydrochrysene.
| Compound Name | 5-(3,4-dimethoxyphenyl)sulfonyl-1,2,3,4,5,6-hexahydrochrysene |
|---|---|
| PubChem CID | 174352406 |
| Molecular Formula | C26H26O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 5-(3,4-dimethoxyphenyl)sulfonyl-1,2,3,4,5,6-hexahydrochrysene |
| SMILES | COc1ccc(S(=O)(=O)C2Cc3ccccc3-c3ccc4c(c32)CCCC4)cc1OC |
| InChI | InChI=1S/C26H26O4S/c1-29-23-14-12-19(16-24(23)30-2)31(27,28)25-15-18-8-4-5-9-20(18)22-13-11-17-7-3-6-10-21(17)26(22)25/h4-5,8-9,11-14,16,25H,3,6-7,10,15H2,1-2H3 |
| InChIKey | ITKOVEYGMULLAV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |