C14H16N2O2S — CID 174526765
(4-pyridin-3-yl-1,3-thiazol-2-yl) 2,2-dimethylbutanoate (PubChem CID 174526765) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is (4-pyridin-3-yl-1,3-thiazol-2-yl) 2,2-dimethylbutanoate.
| Compound Name | (4-pyridin-3-yl-1,3-thiazol-2-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 174526765 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | (4-pyridin-3-yl-1,3-thiazol-2-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)Oc1nc(-c2cccnc2)cs1 |
| InChI | InChI=1S/C14H16N2O2S/c1-4-14(2,3)12(17)18-13-16-11(9-19-13)10-6-5-7-15-8-10/h5-9H,4H2,1-3H3 |
| InChIKey | HHUKJMZAERGQNL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |