C20H23N5O3 — CID 174527190
N-(4-methylpiperazin-1-yl)-5-nitro-3-phenyl-2,3-dihydro-1H-indole-2-carboxamide (PubChem CID 174527190) has the molecular formula C20H23N5O3 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-(4-methylpiperazin-1-yl)-5-nitro-3-phenyl-2,3-dihydro-1H-indole-2-carboxamide.
| Compound Name | N-(4-methylpiperazin-1-yl)-5-nitro-3-phenyl-2,3-dihydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 174527190 |
| Molecular Formula | C20H23N5O3 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | N-(4-methylpiperazin-1-yl)-5-nitro-3-phenyl-2,3-dihydro-1H-indole-2-carboxamide |
| SMILES | CN1CCN(NC(=O)C2Nc3ccc([N+](=O)[O-])cc3C2c2ccccc2)CC1 |
| InChI | InChI=1S/C20H23N5O3/c1-23-9-11-24(12-10-23)22-20(26)19-18(14-5-3-2-4-6-14)16-13-15(25(27)28)7-8-17(16)21-19/h2-8,13,18-19,21H,9-12H2,1H3,(H,22,26) |
| InChIKey | FYSRGDHSGUZTQL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|