C24H24N4O2 — CID 102590728
(3R,4aS,9S,9aR)-7-nitro-9-phenyl-3-propyl-3,4,4a,9,9a,10-hexahydro-1H-acridine-2,2-dicarbonitrile (PubChem CID 102590728) has the molecular formula C24H24N4O2 and a molecular weight of 400.48 g/mol. Its IUPAC name is (3R,4aS,9S,9aR)-7-nitro-9-phenyl-3-propyl-3,4,4a,9,9a,10-hexahydro-1H-acridine-2,2-dicarbonitrile.
| Compound Name | (3R,4aS,9S,9aR)-7-nitro-9-phenyl-3-propyl-3,4,4a,9,9a,10-hexahydro-1H-acridine-2,2-dicarbonitrile |
|---|---|
| PubChem CID | 102590728 |
| Molecular Formula | C24H24N4O2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (3R,4aS,9S,9aR)-7-nitro-9-phenyl-3-propyl-3,4,4a,9,9a,10-hexahydro-1H-acridine-2,2-dicarbonitrile |
| SMILES | CCC[C@@H]1C[C@@H]2Nc3ccc([N+](=O)[O-])cc3[C@H](c3ccccc3)[C@H]2CC1(C#N)C#N |
| InChI | InChI=1S/C24H24N4O2/c1-2-6-17-11-22-20(13-24(17,14-25)15-26)23(16-7-4-3-5-8-16)19-12-18(28(29)30)9-10-21(19)27-22/h3-5,7-10,12,17,20,22-23,27H,2,6,11,13H2,1H3/t17-,20+,22+,23+/m1/s1 |
| InChIKey | XWKYINQEOXGUQZ-BHVFFLMSSA-N |
| XLogP | 5.38 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|