C22H21N3O4 — CID 100936226
1-[(5aR,10bS)-9-nitro-5-phenyl-4,5,5a,6,10b,11-hexahydro-1H-oxazino[4,5-b]carbazol-3-yl]ethanone (PubChem CID 100936226) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 1-[(5aR,10bS)-9-nitro-5-phenyl-4,5,5a,6,10b,11-hexahydro-1H-oxazino[4,5-b]carbazol-3-yl]ethanone.
| Compound Name | 1-[(5aR,10bS)-9-nitro-5-phenyl-4,5,5a,6,10b,11-hexahydro-1H-oxazino[4,5-b]carbazol-3-yl]ethanone |
|---|---|
| PubChem CID | 100936226 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 1-[(5aR,10bS)-9-nitro-5-phenyl-4,5,5a,6,10b,11-hexahydro-1H-oxazino[4,5-b]carbazol-3-yl]ethanone |
| SMILES | CC(=O)N1CC2=C(CO1)C[C@H]1c3cc([N+](=O)[O-])ccc3N[C@H]1C2c1ccccc1 |
| InChI | InChI=1S/C22H21N3O4/c1-13(26)24-11-19-15(12-29-24)9-18-17-10-16(25(27)28)7-8-20(17)23-22(18)21(19)14-5-3-2-4-6-14/h2-8,10,18,21-23H,9,11-12H2,1H3/t18-,21?,22+/m0/s1 |
| InChIKey | CXADPCIQEKMPGR-IDTFUIECSA-N |
| XLogP | 3.75 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|