C19H20ClNO5 — CID 174527496
4-[4-[(5-chloro-2-hydroxybenzoyl)amino]-2-methylbutan-2-yl]benzenecarboperoxoic acid (PubChem CID 174527496) has the molecular formula C19H20ClNO5 and a molecular weight of 377.82 g/mol. Its IUPAC name is 4-[4-[(5-chloro-2-hydroxybenzoyl)amino]-2-methylbutan-2-yl]benzenecarboperoxoic acid.
| Compound Name | 4-[4-[(5-chloro-2-hydroxybenzoyl)amino]-2-methylbutan-2-yl]benzenecarboperoxoic acid |
|---|---|
| PubChem CID | 174527496 |
| Molecular Formula | C19H20ClNO5 |
| Molecular Weight | 377.82 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 4-[4-[(5-chloro-2-hydroxybenzoyl)amino]-2-methylbutan-2-yl]benzenecarboperoxoic acid |
| SMILES | CC(C)(CCNC(=O)c1cc(Cl)ccc1O)c1ccc(C(=O)OO)cc1 |
| InChI | InChI=1S/C19H20ClNO5/c1-19(2,13-5-3-12(4-6-13)18(24)26-25)9-10-21-17(23)15-11-14(20)7-8-16(15)22/h3-8,11,22,25H,9-10H2,1-2H3,(H,21,23) |
| InChIKey | QXTGDZHNPROZNM-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.82 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|