C22H24N2O — CID 174527684
3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(2-methoxyphenyl)butan-2-imine (PubChem CID 174527684) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(2-methoxyphenyl)butan-2-imine.
| Compound Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(2-methoxyphenyl)butan-2-imine |
|---|---|
| PubChem CID | 174527684 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(2-methoxyphenyl)butan-2-imine |
| SMILES | [H]/N=C(\C)C(Cc1ccccc1OC)c1cn2c3c(cccc13)CCC2 |
| InChI | InChI=1S/C22H24N2O/c1-15(23)19(13-17-7-3-4-11-21(17)25-2)20-14-24-12-6-9-16-8-5-10-18(20)22(16)24/h3-5,7-8,10-11,14,19,23H,6,9,12-13H2,1-2H3/b23-15+ |
| InChIKey | TWIXHXAGQYBEOD-HZHRSRAPSA-N |
| XLogP | 4.96 |
| TPSA | 38.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|