C24H21N3O2 — CID 91506876
3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1-methylindol-3-yl)-1H-pyrrole-2,5-diol (PubChem CID 91506876) has the molecular formula C24H21N3O2 and a molecular weight of 383.45 g/mol. Its IUPAC name is 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1-methylindol-3-yl)-1H-pyrrole-2,5-diol.
| Compound Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1-methylindol-3-yl)-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91506876 |
| Molecular Formula | C24H21N3O2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1-methylindol-3-yl)-1H-pyrrole-2,5-diol |
| SMILES | Cn1cc(-c2c(O)[nH]c(O)c2-c2cn3c4c(cccc24)CCC3)c2ccccc21 |
| InChI | InChI=1S/C24H21N3O2/c1-26-12-17(15-8-2-3-10-19(15)26)20-21(24(29)25-23(20)28)18-13-27-11-5-7-14-6-4-9-16(18)22(14)27/h2-4,6,8-10,12-13,25,28-29H,5,7,11H2,1H3 |
| InChIKey | ITXLBAAJFLUBEN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 66.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |