C26H22N4O2 — CID 20729412
3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1,9-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-3-yl)pyrrole-2,5-dione (PubChem CID 20729412) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1,9-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1,9-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 20729412 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(1,9-diazatricyclo[6.4.1.04,13]trideca-2,4(13),5,7-tetraen-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2cn3c4c(cccc24)NCCC3)=C1c1cn2c3c(cccc13)CCC2 |
| InChI | InChI=1S/C26H22N4O2/c31-25-21(18-13-29-11-3-6-15-5-1-7-16(18)23(15)29)22(26(32)28-25)19-14-30-12-4-10-27-20-9-2-8-17(19)24(20)30/h1-2,5,7-9,13-14,27H,3-4,6,10-12H2,(H,28,31,32) |
| InChIKey | LBWDDADVFAKCPX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|