C27H21N3O2S — CID 162035682
3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-thiophen-2-ylpyrrole-2,5-dione;1H-indole (PubChem CID 162035682) has the molecular formula C27H21N3O2S and a molecular weight of 451.55 g/mol. Its IUPAC name is 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-thiophen-2-ylpyrrole-2,5-dione;1H-indole.
| Compound Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-thiophen-2-ylpyrrole-2,5-dione;1H-indole |
|---|---|
| PubChem CID | 162035682 |
| Molecular Formula | C27H21N3O2S |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-thiophen-2-ylpyrrole-2,5-dione;1H-indole |
| SMILES | O=C1NC(=O)C(c2cn3c4c(cccc24)CCC3)=C1c1cccs1.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C19H14N2O2S.C8H7N/c22-18-15(16(19(23)20-18)14-7-3-9-24-14)13-10-21-8-2-5-11-4-1-6-12(13)17(11)21;1-2-4-8-7(3-1)5-6-9-8/h1,3-4,6-7,9-10H,2,5,8H2,(H,20,22,23);1-6,9H |
| InChIKey | YWPOFGPIBMSPPR-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|