C23H22N2O4 — CID 91608355
3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(2,5-dimethoxyphenyl)-1H-pyrrole-2,5-diol (PubChem CID 91608355) has the molecular formula C23H22N2O4 and a molecular weight of 390.44 g/mol. Its IUPAC name is 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(2,5-dimethoxyphenyl)-1H-pyrrole-2,5-diol.
| Compound Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(2,5-dimethoxyphenyl)-1H-pyrrole-2,5-diol |
|---|---|
| PubChem CID | 91608355 |
| Molecular Formula | C23H22N2O4 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-4-(2,5-dimethoxyphenyl)-1H-pyrrole-2,5-diol |
| SMILES | COc1ccc(OC)c(-c2c(O)[nH]c(O)c2-c2cn3c4c(cccc24)CCC3)c1 |
| InChI | InChI=1S/C23H22N2O4/c1-28-14-8-9-18(29-2)16(11-14)19-20(23(27)24-22(19)26)17-12-25-10-4-6-13-5-3-7-15(17)21(13)25/h3,5,7-9,11-12,24,26-27H,4,6,10H2,1-2H3 |
| InChIKey | RSCFWYQTIBTHCV-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 79.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |