C11H14F2O2 — CID 174528790
6-butyl-3-(difluoromethoxy)cyclohexa-2,4-dien-1-one (PubChem CID 174528790) has the molecular formula C11H14F2O2 and a molecular weight of 216.23 g/mol. Its IUPAC name is 6-butyl-3-(difluoromethoxy)cyclohexa-2,4-dien-1-one.
| Compound Name | 6-butyl-3-(difluoromethoxy)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 174528790 |
| Molecular Formula | C11H14F2O2 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 6-butyl-3-(difluoromethoxy)cyclohexa-2,4-dien-1-one |
| SMILES | CCCCC1C=CC(OC(F)F)=CC1=O |
| InChI | InChI=1S/C11H14F2O2/c1-2-3-4-8-5-6-9(7-10(8)14)15-11(12)13/h5-8,11H,2-4H2,1H3 |
| InChIKey | MAQWIXYHWOPRKZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |