C22H32O3Si — CID 174529704
1,4-diphenylbutan-2-yl(triethoxy)silane (PubChem CID 174529704) has the molecular formula C22H32O3Si and a molecular weight of 372.58 g/mol. Its IUPAC name is 1,4-diphenylbutan-2-yl(triethoxy)silane.
| Compound Name | 1,4-diphenylbutan-2-yl(triethoxy)silane |
|---|---|
| PubChem CID | 174529704 |
| Molecular Formula | C22H32O3Si |
| Molecular Weight | 372.58 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 1,4-diphenylbutan-2-yl(triethoxy)silane |
| SMILES | CCO[Si](OCC)(OCC)C(CCc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H32O3Si/c1-4-23-26(24-5-2,25-6-3)22(19-21-15-11-8-12-16-21)18-17-20-13-9-7-10-14-20/h7-16,22H,4-6,17-19H2,1-3H3 |
| InChIKey | AJJAKPVCZMGUCV-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.58 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|