C30H47NO8 — CID 174532071
3-[2-[methyl-(1-phenyl-2-propylheptyl)amino]butyl]pentane-1,2,4,5-tetracarboxylic acid (PubChem CID 174532071) has the molecular formula C30H47NO8 and a molecular weight of 549.71 g/mol. Its IUPAC name is 3-[2-[methyl-(1-phenyl-2-propylheptyl)amino]butyl]pentane-1,2,4,5-tetracarboxylic acid.
| Compound Name | 3-[2-[methyl-(1-phenyl-2-propylheptyl)amino]butyl]pentane-1,2,4,5-tetracarboxylic acid |
|---|---|
| PubChem CID | 174532071 |
| Molecular Formula | C30H47NO8 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.33 |
| IUPAC Name | 3-[2-[methyl-(1-phenyl-2-propylheptyl)amino]butyl]pentane-1,2,4,5-tetracarboxylic acid |
| SMILES | CCCCCC(CCC)C(c1ccccc1)N(C)C(CC)CC(C(CC(=O)O)C(=O)O)C(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C30H47NO8/c1-5-8-10-14-20(13-6-2)28(21-15-11-9-12-16-21)31(4)22(7-3)17-23(24(29(36)37)18-26(32)33)25(30(38)39)19-27(34)35/h9,11-12,15-16,20,22-25,28H,5-8,10,13-14,17-19H2,1-4H3,(H,32,33)(H,34,35)(H,36,37)(H,38,39) |
| InChIKey | NVXRCSHQLSWATM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 152.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|