C11H17N3O5 — CID 174532466
2-[2-[(2-isocyanatoacetyl)amino]propanoylamino]-3-methylbutanoic acid (PubChem CID 174532466) has the molecular formula C11H17N3O5 and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-[2-[(2-isocyanatoacetyl)amino]propanoylamino]-3-methylbutanoic acid.
| Compound Name | 2-[2-[(2-isocyanatoacetyl)amino]propanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 174532466 |
| Molecular Formula | C11H17N3O5 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-[2-[(2-isocyanatoacetyl)amino]propanoylamino]-3-methylbutanoic acid |
| SMILES | CC(NC(=O)CN=C=O)C(=O)NC(C(=O)O)C(C)C |
| InChI | InChI=1S/C11H17N3O5/c1-6(2)9(11(18)19)14-10(17)7(3)13-8(16)4-12-5-15/h6-7,9H,4H2,1-3H3,(H,13,16)(H,14,17)(H,18,19) |
| InChIKey | MLEVSBAZTOMQIQ-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|