C11H18N2 — CID 174532713
(2,4-diethyl-3-methylphenyl)hydrazine (PubChem CID 174532713) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (2,4-diethyl-3-methylphenyl)hydrazine.
| Compound Name | (2,4-diethyl-3-methylphenyl)hydrazine |
|---|---|
| PubChem CID | 174532713 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (2,4-diethyl-3-methylphenyl)hydrazine |
| SMILES | CCc1ccc(NN)c(CC)c1C |
| InChI | InChI=1S/C11H18N2/c1-4-9-6-7-11(13-12)10(5-2)8(9)3/h6-7,13H,4-5,12H2,1-3H3 |
| InChIKey | UXMGEBWCCITVAL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|