C12H21ClN2 — CID 174695946
2,5-diethyl-1-N,3-dimethylbenzene-1,4-diamine;hydrochloride (PubChem CID 174695946) has the molecular formula C12H21ClN2 and a molecular weight of 228.77 g/mol. Its IUPAC name is 2,5-diethyl-1-N,3-dimethylbenzene-1,4-diamine;hydrochloride.
| Compound Name | 2,5-diethyl-1-N,3-dimethylbenzene-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 174695946 |
| Molecular Formula | C12H21ClN2 |
| Molecular Weight | 228.77 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 2,5-diethyl-1-N,3-dimethylbenzene-1,4-diamine;hydrochloride |
| SMILES | CCc1cc(NC)c(CC)c(C)c1N.Cl |
| InChI | InChI=1S/C12H20N2.ClH/c1-5-9-7-11(14-4)10(6-2)8(3)12(9)13;/h7,14H,5-6,13H2,1-4H3;1H |
| InChIKey | MSEGHZPOIQEDAR-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.77 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|