C26H52NO4+ — CID 174533602
[(Z)-2-(2,3-dihydroxypropoxy)-3-oxoicos-11-enyl]-trimethylazanium (PubChem CID 174533602) has the molecular formula C26H52NO4+ and a molecular weight of 442.71 g/mol. Its IUPAC name is [(Z)-2-(2,3-dihydroxypropoxy)-3-oxoicos-11-enyl]-trimethylazanium.
| Compound Name | [(Z)-2-(2,3-dihydroxypropoxy)-3-oxoicos-11-enyl]-trimethylazanium |
|---|---|
| PubChem CID | 174533602 |
| Molecular Formula | C26H52NO4+ |
| Molecular Weight | 442.71 g/mol |
| Exact Mass | 442.39 |
| IUPAC Name | [(Z)-2-(2,3-dihydroxypropoxy)-3-oxoicos-11-enyl]-trimethylazanium |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)C(C[N+](C)(C)C)OCC(O)CO |
| InChI | InChI=1S/C26H52NO4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25(30)26(21-27(2,3)4)31-23-24(29)22-28/h12-13,24,26,28-29H,5-11,14-23H2,1-4H3/q+1/b13-12- |
| InChIKey | DCYFZWVJXNUXFH-SEYXRHQNSA-N |
| XLogP | 5.04 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.71 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|