C25H44NO2P — CID 173240501
[3-oxo-1-(trimethylazaniumyl)docosa-7,10,13,16-tetraen-2-yl]oxyphosphanide (PubChem CID 173240501) has the molecular formula C25H44NO2P and a molecular weight of 421.61 g/mol. Its IUPAC name is [3-oxo-1-(trimethylazaniumyl)docosa-7,10,13,16-tetraen-2-yl]oxyphosphanide.
| Compound Name | [3-oxo-1-(trimethylazaniumyl)docosa-7,10,13,16-tetraen-2-yl]oxyphosphanide |
|---|---|
| PubChem CID | 173240501 |
| Molecular Formula | C25H44NO2P |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.31 |
| IUPAC Name | [3-oxo-1-(trimethylazaniumyl)docosa-7,10,13,16-tetraen-2-yl]oxyphosphanide |
| SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)C(C[N+](C)(C)C)O[PH-] |
| InChI | InChI=1S/C25H44NO2P/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(27)25(28-29)23-26(2,3)4/h9-10,12-13,15-16,18-19,25,29H,5-8,11,14,17,20-23H2,1-4H3 |
| InChIKey | KPZFBMVOKNTZQY-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|