molecular hydrogen;1H-pyridine-2-thione

C5H7NS — CID 174536001

IUPACmolecular hydrogen;1H-pyridine-2-thione
SMILESS=c1cccc[nH]1.[H][H]
InChIInChI=1S/C5H5NS.H2/c7-5-3-1-2-4-6-5;/h1-4H,(H,6,7);1H
InChIKeyWSSIKLPMTOMCEW-UHFFFAOYSA-N
MW113.18 g/mol
LogP1.99
Rot. Bonds

About molecular hydrogen;1H-pyridine-2-thione

molecular hydrogen;1H-pyridine-2-thione (PubChem CID 174536001) has the molecular formula C5H7NS and a molecular weight of 113.18 g/mol. Its IUPAC name is molecular hydrogen;1H-pyridine-2-thione.

Molecular Properties

Compound Namemolecular hydrogen;1H-pyridine-2-thione
PubChem CID174536001
Molecular FormulaC5H7NS
Molecular Weight113.18 g/mol
Exact Mass113.03
IUPAC Namemolecular hydrogen;1H-pyridine-2-thione
SMILESS=c1cccc[nH]1.[H][H]
InChIInChI=1S/C5H5NS.H2/c7-5-3-1-2-4-6-5;/h1-4H,(H,6,7);1H
InChIKeyWSSIKLPMTOMCEW-UHFFFAOYSA-N
XLogP1.99
TPSA15.79 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms7
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500113.18
LogP ≤ 51.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze molecular hydrogen;1H-pyridine-2-thione with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;1H-pyridine-2-thione?
The IUPAC name of molecular hydrogen;1H-pyridine-2-thione (CID 174536001) is molecular hydrogen;1H-pyridine-2-thione.
What is the SMILES notation for molecular hydrogen;1H-pyridine-2-thione?
The canonical SMILES for molecular hydrogen;1H-pyridine-2-thione is S=c1cccc[nH]1.[H][H].
What is the InChIKey of molecular hydrogen;1H-pyridine-2-thione?
The InChIKey is WSSIKLPMTOMCEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NS.H2/c7-5-3-1-2-4-6-5;/h1-4H,(H,6,7);1H.
What are the key properties of molecular hydrogen;1H-pyridine-2-thione?
molecular hydrogen;1H-pyridine-2-thione has a molecular weight of 113.18 g/mol, XLogP of 1.99, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;1H-pyridine-2-thione is sourced from PubChem (CID 174536001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).