About 1H-pyridine-2-thione;3-sulfanylpropyl prop-2-enoate
1H-pyridine-2-thione;3-sulfanylpropyl prop-2-enoate (PubChem CID 174637871) has the molecular formula C11H15NO2S2
and a molecular weight of 257.38 g/mol. Its IUPAC name is 1H-pyridine-2-thione;3-sulfanylpropyl prop-2-enoate.
Molecular Properties
| Compound Name | 1H-pyridine-2-thione;3-sulfanylpropyl prop-2-enoate |
| PubChem CID | 174637871 |
| Molecular Formula | C11H15NO2S2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 1H-pyridine-2-thione;3-sulfanylpropyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCS.S=c1cccc[nH]1 |
| InChI | InChI=1S/C6H10O2S.C5H5NS/c1-2-6(7)8-4-3-5-9;7-5-3-1-2-4-6-5/h2,9H,1,3-5H2;1-4H,(H,6,7) |
| InChIKey | JLZCHDASOHPSNU-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyridine-2-thione;3-sulfanylpropyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyridine-2-thione;3-sulfanylpropyl prop-2-enoate?
The IUPAC name of 1H-pyridine-2-thione;3-sulfanylpropyl prop-2-enoate (CID 174637871) is 1H-pyridine-2-thione;3-sulfanylpropyl prop-2-enoate.
What is the SMILES notation for 1H-pyridine-2-thione;3-sulfanylpropyl prop-2-enoate?
The canonical SMILES for 1H-pyridine-2-thione;3-sulfanylpropyl prop-2-enoate is C=CC(=O)OCCCS.S=c1cccc[nH]1.
What is the InChIKey of 1H-pyridine-2-thione;3-sulfanylpropyl prop-2-enoate?
The InChIKey is JLZCHDASOHPSNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2S.C5H5NS/c1-2-6(7)8-4-3-5-9;7-5-3-1-2-4-6-5/h2,9H,1,3-5H2;1-4H,(H,6,7).
What are the key properties of 1H-pyridine-2-thione;3-sulfanylpropyl prop-2-enoate?
1H-pyridine-2-thione;3-sulfanylpropyl prop-2-enoate has a molecular weight of 257.38 g/mol, XLogP of 2.78, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyridine-2-thione;3-sulfanylpropyl prop-2-enoate is sourced from PubChem (CID 174637871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).