C31H33FN4O2S — CID 174536193
2-(4-fluorophenyl)-3-[4-[4-[4-(1H-indol-3-yl)piperidine-1-carbonyl]-1,3-thiazol-2-yl]piperidin-1-yl]propanal (PubChem CID 174536193) has the molecular formula C31H33FN4O2S and a molecular weight of 544.70 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-3-[4-[4-[4-(1H-indol-3-yl)piperidine-1-carbonyl]-1,3-thiazol-2-yl]piperidin-1-yl]propanal.
| Compound Name | 2-(4-fluorophenyl)-3-[4-[4-[4-(1H-indol-3-yl)piperidine-1-carbonyl]-1,3-thiazol-2-yl]piperidin-1-yl]propanal |
|---|---|
| PubChem CID | 174536193 |
| Molecular Formula | C31H33FN4O2S |
| Molecular Weight | 544.70 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 2-(4-fluorophenyl)-3-[4-[4-[4-(1H-indol-3-yl)piperidine-1-carbonyl]-1,3-thiazol-2-yl]piperidin-1-yl]propanal |
| SMILES | O=CC(CN1CCC(c2nc(C(=O)N3CCC(c4c[nH]c5ccccc45)CC3)cs2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C31H33FN4O2S/c32-25-7-5-21(6-8-25)24(19-37)18-35-13-9-23(10-14-35)30-34-29(20-39-30)31(38)36-15-11-22(12-16-36)27-17-33-28-4-2-1-3-26(27)28/h1-8,17,19-20,22-24,33H,9-16,18H2 |
| InChIKey | NXMSPLRYRPWWJK-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.70 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|