C31H40N4O2S2 — CID 87889890
(5S)-5-[4-[4-[4-(1H-indol-3-yl)piperidine-1-carbonyl]-1,3-thiazol-2-yl]piperidin-1-yl]-5-(thiolan-3-yl)pentanal (PubChem CID 87889890) has the molecular formula C31H40N4O2S2 and a molecular weight of 564.82 g/mol. Its IUPAC name is (5S)-5-[4-[4-[4-(1H-indol-3-yl)piperidine-1-carbonyl]-1,3-thiazol-2-yl]piperidin-1-yl]-5-(thiolan-3-yl)pentanal.
| Compound Name | (5S)-5-[4-[4-[4-(1H-indol-3-yl)piperidine-1-carbonyl]-1,3-thiazol-2-yl]piperidin-1-yl]-5-(thiolan-3-yl)pentanal |
|---|---|
| PubChem CID | 87889890 |
| Molecular Formula | C31H40N4O2S2 |
| Molecular Weight | 564.82 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | (5S)-5-[4-[4-[4-(1H-indol-3-yl)piperidine-1-carbonyl]-1,3-thiazol-2-yl]piperidin-1-yl]-5-(thiolan-3-yl)pentanal |
| SMILES | O=CCCC[C@@H](C1CCSC1)N1CCC(c2nc(C(=O)N3CCC(c4c[nH]c5ccccc45)CC3)cs2)CC1 |
| InChI | InChI=1S/C31H40N4O2S2/c36-17-4-3-7-29(24-12-18-38-20-24)34-13-10-23(11-14-34)30-33-28(21-39-30)31(37)35-15-8-22(9-16-35)26-19-32-27-6-2-1-5-25(26)27/h1-2,5-6,17,19,21-24,29,32H,3-4,7-16,18,20H2/t24?,29-/m0/s1 |
| InChIKey | FNHJHXAXMDIWMV-PEFOLFAWSA-N |
| XLogP | 6.31 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.82 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|