About dimethoxysilane;trimethyl(oxetan-2-yloxy)azanium
dimethoxysilane;trimethyl(oxetan-2-yloxy)azanium (PubChem CID 174536200) has the molecular formula C8H22NO4Si+
and a molecular weight of 224.35 g/mol. Its IUPAC name is dimethoxysilane;trimethyl(oxetan-2-yloxy)azanium.
Molecular Properties
| Compound Name | dimethoxysilane;trimethyl(oxetan-2-yloxy)azanium |
| PubChem CID | 174536200 |
| Molecular Formula | C8H22NO4Si+ |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | dimethoxysilane;trimethyl(oxetan-2-yloxy)azanium |
| SMILES | CO[SiH2]OC.C[N+](C)(C)OC1CCO1 |
| InChI | InChI=1S/C6H14NO2.C2H8O2Si/c1-7(2,3)9-6-4-5-8-6;1-3-5-4-2/h6H,4-5H2,1-3H3;5H2,1-2H3/q+1; |
| InChIKey | JTLVXWQEMYQIGU-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dimethoxysilane;trimethyl(oxetan-2-yloxy)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethoxysilane;trimethyl(oxetan-2-yloxy)azanium?
The IUPAC name of dimethoxysilane;trimethyl(oxetan-2-yloxy)azanium (CID 174536200) is dimethoxysilane;trimethyl(oxetan-2-yloxy)azanium.
What is the SMILES notation for dimethoxysilane;trimethyl(oxetan-2-yloxy)azanium?
The canonical SMILES for dimethoxysilane;trimethyl(oxetan-2-yloxy)azanium is CO[SiH2]OC.C[N+](C)(C)OC1CCO1.
What is the InChIKey of dimethoxysilane;trimethyl(oxetan-2-yloxy)azanium?
The InChIKey is JTLVXWQEMYQIGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14NO2.C2H8O2Si/c1-7(2,3)9-6-4-5-8-6;1-3-5-4-2/h6H,4-5H2,1-3H3;5H2,1-2H3/q+1;.
What are the key properties of dimethoxysilane;trimethyl(oxetan-2-yloxy)azanium?
dimethoxysilane;trimethyl(oxetan-2-yloxy)azanium has a molecular weight of 224.35 g/mol, XLogP of -0.35, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethoxysilane;trimethyl(oxetan-2-yloxy)azanium is sourced from PubChem (CID 174536200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).