About 1-[(2S)-4-benzylpiperazin-2-yl]propan-2-one;tert-butyl formate
1-[(2S)-4-benzylpiperazin-2-yl]propan-2-one;tert-butyl formate (PubChem CID 174536749) has the molecular formula C19H30N2O3
and a molecular weight of 334.46 g/mol. Its IUPAC name is 1-[(2S)-4-benzylpiperazin-2-yl]propan-2-one;tert-butyl formate.
Molecular Properties
| Compound Name | 1-[(2S)-4-benzylpiperazin-2-yl]propan-2-one;tert-butyl formate |
| PubChem CID | 174536749 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | 1-[(2S)-4-benzylpiperazin-2-yl]propan-2-one;tert-butyl formate |
| SMILES | CC(=O)C[C@H]1CN(Cc2ccccc2)CCN1.CC(C)(C)OC=O |
| InChI | InChI=1S/C14H20N2O.C5H10O2/c1-12(17)9-14-11-16(8-7-15-14)10-13-5-3-2-4-6-13;1-5(2,3)7-4-6/h2-6,14-15H,7-11H2,1H3;4H,1-3H3/t14-;/m0./s1 |
| InChIKey | HURDIDNABLPMNR-UQKRIMTDSA-N |
| XLogP | 2.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S)-4-benzylpiperazin-2-yl]propan-2-one;tert-butyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-4-benzylpiperazin-2-yl]propan-2-one;tert-butyl formate?
The IUPAC name of 1-[(2S)-4-benzylpiperazin-2-yl]propan-2-one;tert-butyl formate (CID 174536749) is 1-[(2S)-4-benzylpiperazin-2-yl]propan-2-one;tert-butyl formate.
What is the SMILES notation for 1-[(2S)-4-benzylpiperazin-2-yl]propan-2-one;tert-butyl formate?
The canonical SMILES for 1-[(2S)-4-benzylpiperazin-2-yl]propan-2-one;tert-butyl formate is CC(=O)C[C@H]1CN(Cc2ccccc2)CCN1.CC(C)(C)OC=O.
What is the InChIKey of 1-[(2S)-4-benzylpiperazin-2-yl]propan-2-one;tert-butyl formate?
The InChIKey is HURDIDNABLPMNR-UQKRIMTDSA-N. The full InChI is InChI=1S/C14H20N2O.C5H10O2/c1-12(17)9-14-11-16(8-7-15-14)10-13-5-3-2-4-6-13;1-5(2,3)7-4-6/h2-6,14-15H,7-11H2,1H3;4H,1-3H3/t14-;/m0./s1.
What are the key properties of 1-[(2S)-4-benzylpiperazin-2-yl]propan-2-one;tert-butyl formate?
1-[(2S)-4-benzylpiperazin-2-yl]propan-2-one;tert-butyl formate has a molecular weight of 334.46 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-4-benzylpiperazin-2-yl]propan-2-one;tert-butyl formate is sourced from PubChem (CID 174536749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).