C19H31N3O2 — CID 82667865
tert-butyl N-[2-(4-benzylpiperazin-2-yl)propyl]carbamate (PubChem CID 82667865) has the molecular formula C19H31N3O2 and a molecular weight of 333.48 g/mol. Its IUPAC name is tert-butyl N-[2-(4-benzylpiperazin-2-yl)propyl]carbamate.
| Compound Name | tert-butyl N-[2-(4-benzylpiperazin-2-yl)propyl]carbamate |
|---|---|
| PubChem CID | 82667865 |
| Molecular Formula | C19H31N3O2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.24 |
| IUPAC Name | tert-butyl N-[2-(4-benzylpiperazin-2-yl)propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)C1CN(Cc2ccccc2)CCN1 |
| InChI | InChI=1S/C19H31N3O2/c1-15(12-21-18(23)24-19(2,3)4)17-14-22(11-10-20-17)13-16-8-6-5-7-9-16/h5-9,15,17,20H,10-14H2,1-4H3,(H,21,23) |
| InChIKey | UXUYXKMOCWYZOY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |