C31H41FN2O2 — CID 155724928
(3R)-1-benzyl-3-fluoropyrrolidine;N-benzyl-N-methyl-1-phenylmethanamine;tert-butyl formate (PubChem CID 155724928) has the molecular formula C31H41FN2O2 and a molecular weight of 492.68 g/mol. Its IUPAC name is (3R)-1-benzyl-3-fluoropyrrolidine;N-benzyl-N-methyl-1-phenylmethanamine;tert-butyl formate.
| Compound Name | (3R)-1-benzyl-3-fluoropyrrolidine;N-benzyl-N-methyl-1-phenylmethanamine;tert-butyl formate |
|---|---|
| PubChem CID | 155724928 |
| Molecular Formula | C31H41FN2O2 |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | (3R)-1-benzyl-3-fluoropyrrolidine;N-benzyl-N-methyl-1-phenylmethanamine;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.CN(Cc1ccccc1)Cc1ccccc1.F[C@@H]1CCN(Cc2ccccc2)C1 |
| InChI | InChI=1S/C15H17N.C11H14FN.C5H10O2/c1-16(12-14-8-4-2-5-9-14)13-15-10-6-3-7-11-15;12-11-6-7-13(9-11)8-10-4-2-1-3-5-10;1-5(2,3)7-4-6/h2-11H,12-13H2,1H3;1-5,11H,6-9H2;4H,1-3H3/t;11-;/m.1./s1 |
| InChIKey | JGJARTDNGGXGET-OUTUKCSBSA-N |
| XLogP | 6.51 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|