About potassium;butane;silicic acid
potassium;butane;silicic acid (PubChem CID 174536784) has the molecular formula C4H13KO4Si
and a molecular weight of 192.33 g/mol. Its IUPAC name is potassium;butane;silicic acid.
Molecular Properties
| Compound Name | potassium;butane;silicic acid |
| PubChem CID | 174536784 |
| Molecular Formula | C4H13KO4Si |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.02 |
| IUPAC Name | potassium;butane;silicic acid |
| SMILES | O[Si](O)(O)O.[CH2-]CCC.[K+] |
| InChI | InChI=1S/C4H9.K.H4O4Si/c1-3-4-2;;1-5(2,3)4/h1,3-4H2,2H3;;1-4H/q-1;+1; |
| InChIKey | BJJLPGPJWZEJNU-UHFFFAOYSA-N |
| XLogP | -3.98 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | -3.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium;butane;silicic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;butane;silicic acid?
The IUPAC name of potassium;butane;silicic acid (CID 174536784) is potassium;butane;silicic acid.
What is the SMILES notation for potassium;butane;silicic acid?
The canonical SMILES for potassium;butane;silicic acid is O[Si](O)(O)O.[CH2-]CCC.[K+].
What is the InChIKey of potassium;butane;silicic acid?
The InChIKey is BJJLPGPJWZEJNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.K.H4O4Si/c1-3-4-2;;1-5(2,3)4/h1,3-4H2,2H3;;1-4H/q-1;+1;.
What are the key properties of potassium;butane;silicic acid?
potassium;butane;silicic acid has a molecular weight of 192.33 g/mol, XLogP of -3.98, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;butane;silicic acid is sourced from PubChem (CID 174536784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).