About CID 174537028
CID 174537028 (PubChem CID 174537028) has the molecular formula C3H6BO2
and a molecular weight of 84.89 g/mol.
Molecular Properties
| Compound Name | CID 174537028 |
| PubChem CID | 174537028 |
| Molecular Formula | C3H6BO2 |
| Molecular Weight | 84.89 g/mol |
| Exact Mass | 85.05 |
| IUPAC Name | — |
| SMILES | CC(=O)CO.[B] |
| InChI | InChI=1S/C3H6O2.B/c1-3(5)2-4;/h4H,2H2,1H3; |
| InChIKey | MPAFINBQLZMQQJ-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 84.89 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174537028 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174537028?
The IUPAC name of CID 174537028 (CID 174537028) is not available.
What is the SMILES notation for CID 174537028?
The canonical SMILES for CID 174537028 is CC(=O)CO.[B].
What is the InChIKey of CID 174537028?
The InChIKey is MPAFINBQLZMQQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.B/c1-3(5)2-4;/h4H,2H2,1H3;.
What are the key properties of CID 174537028?
CID 174537028 has a molecular weight of 84.89 g/mol, XLogP of -0.81, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174537028 is sourced from PubChem (CID 174537028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).