C16H12Cl2FNO — CID 174539901
7-chloro-2-[(4-chlorophenyl)methyl]-5-fluoro-1,3-dihydroisoindole-1-carbaldehyde (PubChem CID 174539901) has the molecular formula C16H12Cl2FNO and a molecular weight of 324.18 g/mol. Its IUPAC name is 7-chloro-2-[(4-chlorophenyl)methyl]-5-fluoro-1,3-dihydroisoindole-1-carbaldehyde.
| Compound Name | 7-chloro-2-[(4-chlorophenyl)methyl]-5-fluoro-1,3-dihydroisoindole-1-carbaldehyde |
|---|---|
| PubChem CID | 174539901 |
| Molecular Formula | C16H12Cl2FNO |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 7-chloro-2-[(4-chlorophenyl)methyl]-5-fluoro-1,3-dihydroisoindole-1-carbaldehyde |
| SMILES | O=CC1c2c(Cl)cc(F)cc2CN1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12Cl2FNO/c17-12-3-1-10(2-4-12)7-20-8-11-5-13(19)6-14(18)16(11)15(20)9-21/h1-6,9,15H,7-8H2 |
| InChIKey | MLESDZVNFMQHBG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|