C21H24N4O5S2 — CID 174541583
N-[2-formyl-4-[2-[(2-methoxyphenyl)carbamothioyl]hydrazinyl]-4-oxo-1-sulfanylbutyl]-4-methoxybenzamide (PubChem CID 174541583) has the molecular formula C21H24N4O5S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is N-[2-formyl-4-[2-[(2-methoxyphenyl)carbamothioyl]hydrazinyl]-4-oxo-1-sulfanylbutyl]-4-methoxybenzamide.
| Compound Name | N-[2-formyl-4-[2-[(2-methoxyphenyl)carbamothioyl]hydrazinyl]-4-oxo-1-sulfanylbutyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 174541583 |
| Molecular Formula | C21H24N4O5S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | N-[2-formyl-4-[2-[(2-methoxyphenyl)carbamothioyl]hydrazinyl]-4-oxo-1-sulfanylbutyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(S)C(C=O)CC(=O)NNC(=S)Nc2ccccc2OC)cc1 |
| InChI | InChI=1S/C21H24N4O5S2/c1-29-15-9-7-13(8-10-15)19(28)23-20(31)14(12-26)11-18(27)24-25-21(32)22-16-5-3-4-6-17(16)30-2/h3-10,12,14,20,31H,11H2,1-2H3,(H,23,28)(H,24,27)(H2,22,25,32) |
| InChIKey | NOJZGIHXPYYEGA-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|