C17H19O6P — CID 174541944
[4-(2-ethoxy-4-methoxybenzoyl)phenyl]methylphosphonic acid (PubChem CID 174541944) has the molecular formula C17H19O6P and a molecular weight of 350.31 g/mol. Its IUPAC name is [4-(2-ethoxy-4-methoxybenzoyl)phenyl]methylphosphonic acid.
| Compound Name | [4-(2-ethoxy-4-methoxybenzoyl)phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 174541944 |
| Molecular Formula | C17H19O6P |
| Molecular Weight | 350.31 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | [4-(2-ethoxy-4-methoxybenzoyl)phenyl]methylphosphonic acid |
| SMILES | CCOc1cc(OC)ccc1C(=O)c1ccc(CP(=O)(O)O)cc1 |
| InChI | InChI=1S/C17H19O6P/c1-3-23-16-10-14(22-2)8-9-15(16)17(18)13-6-4-12(5-7-13)11-24(19,20)21/h4-10H,3,11H2,1-2H3,(H2,19,20,21) |
| InChIKey | ZIMRAOSDAGIURR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|