C11H10N2S2 — CID 174543730
2-prop-2-enyl-4-pyridin-3-yl-1-sulfanylidene-1,3-thiazole (PubChem CID 174543730) has the molecular formula C11H10N2S2 and a molecular weight of 234.35 g/mol. Its IUPAC name is 2-prop-2-enyl-4-pyridin-3-yl-1-sulfanylidene-1,3-thiazole.
| Compound Name | 2-prop-2-enyl-4-pyridin-3-yl-1-sulfanylidene-1,3-thiazole |
|---|---|
| PubChem CID | 174543730 |
| Molecular Formula | C11H10N2S2 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-prop-2-enyl-4-pyridin-3-yl-1-sulfanylidene-1,3-thiazole |
| SMILES | C=CCC1=NC(c2cccnc2)=CS1=S |
| InChI | InChI=1S/C11H10N2S2/c1-2-4-11-13-10(8-15(11)14)9-5-3-6-12-7-9/h2-3,5-8H,1,4H2 |
| InChIKey | IXTWQSFNOJXRTN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|