C12H10N2 — CID 90222004
(4-pyridin-3-ylphenyl)methanimine (PubChem CID 90222004) has the molecular formula C12H10N2 and a molecular weight of 182.23 g/mol. Its IUPAC name is (4-pyridin-3-ylphenyl)methanimine.
| Compound Name | (4-pyridin-3-ylphenyl)methanimine |
|---|---|
| PubChem CID | 90222004 |
| Molecular Formula | C12H10N2 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | (4-pyridin-3-ylphenyl)methanimine |
| SMILES | [H]/N=C/c1ccc(-c2cccnc2)cc1 |
| InChI | InChI=1S/C12H10N2/c13-8-10-3-5-11(6-4-10)12-2-1-7-14-9-12/h1-9,13H/b13-8+ |
| InChIKey | ORVUAYBAGCXVTH-MDWZMJQESA-N |
| XLogP | 2.75 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|