C14H14FN3O3S2 — CID 174544785
N-fluoro-N-[5-(1,3-thiazol-2-ylsulfamoyl)-2,3-dihydro-1H-inden-2-yl]acetamide (PubChem CID 174544785) has the molecular formula C14H14FN3O3S2 and a molecular weight of 355.42 g/mol. Its IUPAC name is N-fluoro-N-[5-(1,3-thiazol-2-ylsulfamoyl)-2,3-dihydro-1H-inden-2-yl]acetamide.
| Compound Name | N-fluoro-N-[5-(1,3-thiazol-2-ylsulfamoyl)-2,3-dihydro-1H-inden-2-yl]acetamide |
|---|---|
| PubChem CID | 174544785 |
| Molecular Formula | C14H14FN3O3S2 |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-fluoro-N-[5-(1,3-thiazol-2-ylsulfamoyl)-2,3-dihydro-1H-inden-2-yl]acetamide |
| SMILES | CC(=O)N(F)C1Cc2ccc(S(=O)(=O)Nc3nccs3)cc2C1 |
| InChI | InChI=1S/C14H14FN3O3S2/c1-9(19)18(15)12-6-10-2-3-13(8-11(10)7-12)23(20,21)17-14-16-4-5-22-14/h2-5,8,12H,6-7H2,1H3,(H,16,17) |
| InChIKey | HQZRNJPBBBUZIY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|