C11H15BrN4O — CID 174545408
7-bromo-1,3,3-tris(methylamino)indol-2-one (PubChem CID 174545408) has the molecular formula C11H15BrN4O and a molecular weight of 299.17 g/mol. Its IUPAC name is 7-bromo-1,3,3-tris(methylamino)indol-2-one.
| Compound Name | 7-bromo-1,3,3-tris(methylamino)indol-2-one |
|---|---|
| PubChem CID | 174545408 |
| Molecular Formula | C11H15BrN4O |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 7-bromo-1,3,3-tris(methylamino)indol-2-one |
| SMILES | CNN1C(=O)C(NC)(NC)c2cccc(Br)c21 |
| InChI | InChI=1S/C11H15BrN4O/c1-13-11(14-2)7-5-4-6-8(12)9(7)16(15-3)10(11)17/h4-6,13-15H,1-3H3 |
| InChIKey | UUYPHBWUYHQYKY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|