C19H25N3O5S2 — CID 174545523
1-(2-hexanoyl-4-methylphenyl)-3-[5-(2-hydroxyethylsulfonyl)-1,3-thiazol-2-yl]urea (PubChem CID 174545523) has the molecular formula C19H25N3O5S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 1-(2-hexanoyl-4-methylphenyl)-3-[5-(2-hydroxyethylsulfonyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-(2-hexanoyl-4-methylphenyl)-3-[5-(2-hydroxyethylsulfonyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 174545523 |
| Molecular Formula | C19H25N3O5S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 1-(2-hexanoyl-4-methylphenyl)-3-[5-(2-hydroxyethylsulfonyl)-1,3-thiazol-2-yl]urea |
| SMILES | CCCCCC(=O)c1cc(C)ccc1NC(=O)Nc1ncc(S(=O)(=O)CCO)s1 |
| InChI | InChI=1S/C19H25N3O5S2/c1-3-4-5-6-16(24)14-11-13(2)7-8-15(14)21-18(25)22-19-20-12-17(28-19)29(26,27)10-9-23/h7-8,11-12,23H,3-6,9-10H2,1-2H3,(H2,20,21,22,25) |
| InChIKey | UNSRNWDJXKDIOB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 125.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|