C26H24ClN3O4 — CID 174546186
4-chloro-N-cyclobutyl-1-[(4-pyrazol-1-ylphenyl)methoxy]naphthalene-2-carboxamide;formic acid (PubChem CID 174546186) has the molecular formula C26H24ClN3O4 and a molecular weight of 477.95 g/mol. Its IUPAC name is 4-chloro-N-cyclobutyl-1-[(4-pyrazol-1-ylphenyl)methoxy]naphthalene-2-carboxamide;formic acid.
| Compound Name | 4-chloro-N-cyclobutyl-1-[(4-pyrazol-1-ylphenyl)methoxy]naphthalene-2-carboxamide;formic acid |
|---|---|
| PubChem CID | 174546186 |
| Molecular Formula | C26H24ClN3O4 |
| Molecular Weight | 477.95 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 4-chloro-N-cyclobutyl-1-[(4-pyrazol-1-ylphenyl)methoxy]naphthalene-2-carboxamide;formic acid |
| SMILES | O=C(NC1CCC1)c1cc(Cl)c2ccccc2c1OCc1ccc(-n2cccn2)cc1.O=CO |
| InChI | InChI=1S/C25H22ClN3O2.CH2O2/c26-23-15-22(25(30)28-18-5-3-6-18)24(21-8-2-1-7-20(21)23)31-16-17-9-11-19(12-10-17)29-14-4-13-27-29;2-1-3/h1-2,4,7-15,18H,3,5-6,16H2,(H,28,30);1H,(H,2,3) |
| InChIKey | UMNZGROBARYOEB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.95 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|