C23H19F4NO2 — CID 66701260
N-cyclobutyl-4-fluoro-1-[[4-(trifluoromethyl)phenyl]methoxy]naphthalene-2-carboxamide (PubChem CID 66701260) has the molecular formula C23H19F4NO2 and a molecular weight of 417.40 g/mol. Its IUPAC name is N-cyclobutyl-4-fluoro-1-[[4-(trifluoromethyl)phenyl]methoxy]naphthalene-2-carboxamide.
| Compound Name | N-cyclobutyl-4-fluoro-1-[[4-(trifluoromethyl)phenyl]methoxy]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 66701260 |
| Molecular Formula | C23H19F4NO2 |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-cyclobutyl-4-fluoro-1-[[4-(trifluoromethyl)phenyl]methoxy]naphthalene-2-carboxamide |
| SMILES | O=C(NC1CCC1)c1cc(F)c2ccccc2c1OCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H19F4NO2/c24-20-12-19(22(29)28-16-4-3-5-16)21(18-7-2-1-6-17(18)20)30-13-14-8-10-15(11-9-14)23(25,26)27/h1-2,6-12,16H,3-5,13H2,(H,28,29) |
| InChIKey | NMJLJDKQFPSGCP-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |