C21H22N4O3 — CID 174546999
methyl N-[(2S)-4-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]-4-iminobutan-2-yl]carbamate (PubChem CID 174546999) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is methyl N-[(2S)-4-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]-4-iminobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-4-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]-4-iminobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 174546999 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | methyl N-[(2S)-4-[2-(2-hydroxyphenyl)-7-methylquinazolin-4-yl]-4-iminobutan-2-yl]carbamate |
| SMILES | [H]/N=C(\C[C@H](C)NC(=O)OC)c1nc(-c2ccccc2O)nc2cc(C)ccc12 |
| InChI | InChI=1S/C21H22N4O3/c1-12-8-9-14-17(10-12)24-20(15-6-4-5-7-18(15)26)25-19(14)16(22)11-13(2)23-21(27)28-3/h4-10,13,22,26H,11H2,1-3H3,(H,23,27)/b22-16+/t13-/m0/s1 |
| InChIKey | CLNJOQQKCLISIB-UAHGDZPKSA-N |
| XLogP | 3.81 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|