C22H21FN4O2 — CID 174533071
N-[(2R)-4-[6-fluoro-2-(2-hydroxyphenyl)quinazolin-4-yl]-4-iminobutan-2-yl]cyclopropanecarboxamide (PubChem CID 174533071) has the molecular formula C22H21FN4O2 and a molecular weight of 392.43 g/mol. Its IUPAC name is N-[(2R)-4-[6-fluoro-2-(2-hydroxyphenyl)quinazolin-4-yl]-4-iminobutan-2-yl]cyclopropanecarboxamide.
| Compound Name | N-[(2R)-4-[6-fluoro-2-(2-hydroxyphenyl)quinazolin-4-yl]-4-iminobutan-2-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 174533071 |
| Molecular Formula | C22H21FN4O2 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | N-[(2R)-4-[6-fluoro-2-(2-hydroxyphenyl)quinazolin-4-yl]-4-iminobutan-2-yl]cyclopropanecarboxamide |
| SMILES | [H]/N=C(\C[C@@H](C)NC(=O)C1CC1)c1nc(-c2ccccc2O)nc2ccc(F)cc12 |
| InChI | InChI=1S/C22H21FN4O2/c1-12(25-22(29)13-6-7-13)10-17(24)20-16-11-14(23)8-9-18(16)26-21(27-20)15-4-2-3-5-19(15)28/h2-5,8-9,11-13,24,28H,6-7,10H2,1H3,(H,25,29)/b24-17+/t12-/m1/s1 |
| InChIKey | KQCXGEAZHPFYGI-UFMFNWEASA-N |
| XLogP | 3.81 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|