C16H28ClNO4 — CID 174548384
1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;N-propan-2-ylbutan-1-amine;hydrochloride (PubChem CID 174548384) has the molecular formula C16H28ClNO4 and a molecular weight of 333.86 g/mol. Its IUPAC name is 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;N-propan-2-ylbutan-1-amine;hydrochloride.
| Compound Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;N-propan-2-ylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 174548384 |
| Molecular Formula | C16H28ClNO4 |
| Molecular Weight | 333.86 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 1-methylcyclohexa-3,5-diene-1,3-dicarboxylic acid;N-propan-2-ylbutan-1-amine;hydrochloride |
| SMILES | CC1(C(=O)O)C=CC=C(C(=O)O)C1.CCCCNC(C)C.Cl |
| InChI | InChI=1S/C9H10O4.C7H17N.ClH/c1-9(8(12)13)4-2-3-6(5-9)7(10)11;1-4-5-6-8-7(2)3;/h2-4H,5H2,1H3,(H,10,11)(H,12,13);7-8H,4-6H2,1-3H3;1H |
| InChIKey | KUSCGNXFCSQGRJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.86 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|