C31H30F3N5O5S — CID 174550155
[(1R)-1-[3-(benzenesulfonamido)phenyl]-2-[[4-[5-(cyanocarbamoyl)indol-1-yl]-2-methylbutan-2-yl]amino]ethyl] 2,2,2-trifluoroacetate (PubChem CID 174550155) has the molecular formula C31H30F3N5O5S and a molecular weight of 641.67 g/mol. Its IUPAC name is [(1R)-1-[3-(benzenesulfonamido)phenyl]-2-[[4-[5-(cyanocarbamoyl)indol-1-yl]-2-methylbutan-2-yl]amino]ethyl] 2,2,2-trifluoroacetate.
| Compound Name | [(1R)-1-[3-(benzenesulfonamido)phenyl]-2-[[4-[5-(cyanocarbamoyl)indol-1-yl]-2-methylbutan-2-yl]amino]ethyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 174550155 |
| Molecular Formula | C31H30F3N5O5S |
| Molecular Weight | 641.67 g/mol |
| Exact Mass | 641.19 |
| IUPAC Name | [(1R)-1-[3-(benzenesulfonamido)phenyl]-2-[[4-[5-(cyanocarbamoyl)indol-1-yl]-2-methylbutan-2-yl]amino]ethyl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)(CCn1ccc2cc(C(=O)NC#N)ccc21)NC[C@H](OC(=O)C(F)(F)F)c1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C31H30F3N5O5S/c1-30(2,14-16-39-15-13-21-17-23(11-12-26(21)39)28(40)36-20-35)37-19-27(44-29(41)31(32,33)34)22-7-6-8-24(18-22)38-45(42,43)25-9-4-3-5-10-25/h3-13,15,17-18,27,37-38H,14,16,19H2,1-2H3,(H,36,40)/t27-/m0/s1 |
| InChIKey | MZZQUJPQZVWQOP-MHZLTWQESA-N |
| XLogP | 5.26 |
| TPSA | 142.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.67 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|